Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
3-Aminopropionitrile, 98%, stab. with potassium carbonate
CAS: 151-18-8 Molecular Formula: C3H6N2 Molecular Weight (g/mol): 70.10 MDL Number: MFCD00014820 InChI Key: AGSPXMVUFBBBMO-UHFFFAOYSA-N Synonym: 3-aminopropionitrile,2-cyanoethylamine,aminopropionitrile,beta-aminopropionitrile,bapn,3-aminopropiononitrile,beta-cyanoethylamine,propanenitrile, 3-amino,beta-alaninenitrile,propionitrile, 3-amino PubChem CID: 1647 ChEBI: CHEBI:27413 IUPAC Name: 3-aminopropanenitrile SMILES: NCCC#N
| PubChem CID | 1647 |
|---|---|
| CAS | 151-18-8 |
| Molecular Weight (g/mol) | 70.10 |
| ChEBI | CHEBI:27413 |
| MDL Number | MFCD00014820 |
| SMILES | NCCC#N |
| Synonym | 3-aminopropionitrile,2-cyanoethylamine,aminopropionitrile,beta-aminopropionitrile,bapn,3-aminopropiononitrile,beta-cyanoethylamine,propanenitrile, 3-amino,beta-alaninenitrile,propionitrile, 3-amino |
| IUPAC Name | 3-aminopropanenitrile |
| InChI Key | AGSPXMVUFBBBMO-UHFFFAOYSA-N |
| Molecular Formula | C3H6N2 |
2-Amino-5-(trifluoromethyl)benzoic acid, 95%
CAS: 83265-53-6 Molecular Formula: C8H6F3NO2 Molecular Weight (g/mol): 205.136 MDL Number: MFCD01569537 InChI Key: GLCQUPLYYXSPQB-UHFFFAOYSA-N Synonym: 2-amino-5-trifluoromethyl benzoic acid,2-amino-5-trifluoromethyl-benzoic acid,5-trifluoromethylanthranilic acid,5-trifluoromethyl anthranilic acid,benzoic acid, 2-amino-5-trifluoromethyl,2-amino-5-trifluoromethyl-benzoicacid,pubchem12904,4-amino-3-carboxybenzotrifluoride,2-carboxy-4-trifluoromethyl aniline,2-amino-5-trifluoromethyl benzoicacid PubChem CID: 10465535 IUPAC Name: 2-amino-5-(trifluoromethyl)benzoic acid SMILES: C1=CC(=C(C=C1C(F)(F)F)C(=O)O)N
| PubChem CID | 10465535 |
|---|---|
| CAS | 83265-53-6 |
| Molecular Weight (g/mol) | 205.136 |
| MDL Number | MFCD01569537 |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(=O)O)N |
| Synonym | 2-amino-5-trifluoromethyl benzoic acid,2-amino-5-trifluoromethyl-benzoic acid,5-trifluoromethylanthranilic acid,5-trifluoromethyl anthranilic acid,benzoic acid, 2-amino-5-trifluoromethyl,2-amino-5-trifluoromethyl-benzoicacid,pubchem12904,4-amino-3-carboxybenzotrifluoride,2-carboxy-4-trifluoromethyl aniline,2-amino-5-trifluoromethyl benzoicacid |
| IUPAC Name | 2-amino-5-(trifluoromethyl)benzoic acid |
| InChI Key | GLCQUPLYYXSPQB-UHFFFAOYSA-N |
| Molecular Formula | C8H6F3NO2 |
Thermo Scientific Chemicals Vincristine sulfate, 95%
CAS: 2068-78-2 Molecular Formula: C46H56N4O10·H2SO4 Molecular Weight (g/mol): 923.03 MDL Number: MFCD08706469 InChI Key: AQTQHPDCURKLKT-DJOZZVTQSA-N Synonym: vincristine sulfate,methyl 9r,10s,11r,12r,19r-11-acetyloxy-12-ethyl-4-13s,15r,17s-17-ethyl-17-hydroxy-13-methoxycarbonyl-1,11-diazatetracyclo 13.3.1.0?, 1 2 .0?, 1 ? nonadeca-4 12 ,5,7,9-tetraen-13-yl-8-formyl-10-hydroxy-5-methoxy-8,16-diazapentacyclo 10.6.1.0 1 ,?.0 2 ,?.0 PubChem CID: 126963557 SMILES: CCC1(CC2CC(C3=C(CCN(C2)C1)C4=CC=CC=C4N3)(C5=C(C=C6C(=C5)C78CCN9C7C(C=CC9)(C(C(C8N6C=O)(C(=O)OC)O)OC(=O)C)CC)OC)C(=O)OC)O.OS(=O)(=O)O
| PubChem CID | 126963557 |
|---|---|
| CAS | 2068-78-2 |
| Molecular Weight (g/mol) | 923.03 |
| MDL Number | MFCD08706469 |
| SMILES | CCC1(CC2CC(C3=C(CCN(C2)C1)C4=CC=CC=C4N3)(C5=C(C=C6C(=C5)C78CCN9C7C(C=CC9)(C(C(C8N6C=O)(C(=O)OC)O)OC(=O)C)CC)OC)C(=O)OC)O.OS(=O)(=O)O |
| Synonym | vincristine sulfate,methyl 9r,10s,11r,12r,19r-11-acetyloxy-12-ethyl-4-13s,15r,17s-17-ethyl-17-hydroxy-13-methoxycarbonyl-1,11-diazatetracyclo 13.3.1.0?, 1 2 .0?, 1 ? nonadeca-4 12 ,5,7,9-tetraen-13-yl-8-formyl-10-hydroxy-5-methoxy-8,16-diazapentacyclo 10.6.1.0 1 ,?.0 2 ,?.0 |
| InChI Key | AQTQHPDCURKLKT-DJOZZVTQSA-N |
| Molecular Formula | C46H56N4O10·H2SO4 |
Ribonucleic acid from Baker's yeast
CAS: 63231-63-0 MDL Number: MFCD00132196 IUPAC Name: Ribonucleic acid
| CAS | 63231-63-0 |
|---|---|
| MDL Number | MFCD00132196 |
| IUPAC Name | Ribonucleic acid |
Phenothiazine, 99%
CAS: 92-84-2 Molecular Formula: C12H9NS Molecular Weight (g/mol): 199.28 MDL Number: MFCD00005015 InChI Key: WJFKNYWRSNBZNX-UHFFFAOYSA-N Synonym: phenothiazine,thiodiphenylamine,feeno,dibenzothiazine,phenosan,phenthiazine,dibenzo-1,4-thiazine,penthazine,souframine,agrazine PubChem CID: 7108 ChEBI: CHEBI:37931 IUPAC Name: 10H-phenothiazine SMILES: C1=CC=C2C(=C1)NC3=CC=CC=C3S2
| PubChem CID | 7108 |
|---|---|
| CAS | 92-84-2 |
| Molecular Weight (g/mol) | 199.28 |
| ChEBI | CHEBI:37931 |
| MDL Number | MFCD00005015 |
| SMILES | C1=CC=C2C(=C1)NC3=CC=CC=C3S2 |
| Synonym | phenothiazine,thiodiphenylamine,feeno,dibenzothiazine,phenosan,phenthiazine,dibenzo-1,4-thiazine,penthazine,souframine,agrazine |
| IUPAC Name | 10H-phenothiazine |
| InChI Key | WJFKNYWRSNBZNX-UHFFFAOYSA-N |
| Molecular Formula | C12H9NS |
1-(3-Dimethylaminopropyl)-3-ethylcarbodiimide hydrochloride, 98+%
CAS: 25952-53-8 Molecular Formula: C8H18ClN3 Molecular Weight (g/mol): 191.70 MDL Number: MFCD00012503 InChI Key: FPQQSJJWHUJYPU-UHFFFAOYSA-N Synonym: 1-3-dimethylaminopropyl-3-ethylcarbodiimide hydrochloride,edc.hcl,edci,edc hydrochloride,wsc hcl,edac hydrochloride,edac, hydrochloride,1-ethyl-3-3-dimethylaminopropyl carbodiimide hydrochloride,edcl,edac hcl PubChem CID: 2723939 IUPAC Name: 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;hydrochloride SMILES: Cl.CCN=C=NCCCN(C)C
| PubChem CID | 2723939 |
|---|---|
| CAS | 25952-53-8 |
| Molecular Weight (g/mol) | 191.70 |
| MDL Number | MFCD00012503 |
| SMILES | Cl.CCN=C=NCCCN(C)C |
| Synonym | 1-3-dimethylaminopropyl-3-ethylcarbodiimide hydrochloride,edc.hcl,edci,edc hydrochloride,wsc hcl,edac hydrochloride,edac, hydrochloride,1-ethyl-3-3-dimethylaminopropyl carbodiimide hydrochloride,edcl,edac hcl |
| IUPAC Name | 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;hydrochloride |
| InChI Key | FPQQSJJWHUJYPU-UHFFFAOYSA-N |
| Molecular Formula | C8H18ClN3 |
Thermo Scientific Chemicals Xylenol orange, sodium salt, ACS reagent
CAS: 3618-43-7 Molecular Formula: C31H28N2Na4O13S Molecular Weight (g/mol): 760.59
| CAS | 3618-43-7 |
|---|---|
| Molecular Weight (g/mol) | 760.59 |
| Molecular Formula | C31H28N2Na4O13S |
Tri-n-butyl phosphate, 98%, Thermo Scientific Chemicals
CAS: 126-73-8 Molecular Formula: C12H27O4P Molecular Weight (g/mol): 266.32 MDL Number: MFCD00009436 InChI Key: STCOOQWBFONSKY-UHFFFAOYSA-N Synonym: tri-n-butyl phosphate,tributylphosphate,butyl phosphate,phosphoric acid tributyl ester,tributylphosphat,celluphos 4,disflamoll tb,tributilfosfato,tributylfosfaat,tributyle phosphate de PubChem CID: 31357 ChEBI: CHEBI:35019 IUPAC Name: tributyl phosphate SMILES: CCCCOP(=O)(OCCCC)OCCCC
| PubChem CID | 31357 |
|---|---|
| CAS | 126-73-8 |
| Molecular Weight (g/mol) | 266.32 |
| ChEBI | CHEBI:35019 |
| MDL Number | MFCD00009436 |
| SMILES | CCCCOP(=O)(OCCCC)OCCCC |
| Synonym | tri-n-butyl phosphate,tributylphosphate,butyl phosphate,phosphoric acid tributyl ester,tributylphosphat,celluphos 4,disflamoll tb,tributilfosfato,tributylfosfaat,tributyle phosphate de |
| IUPAC Name | tributyl phosphate |
| InChI Key | STCOOQWBFONSKY-UHFFFAOYSA-N |
| Molecular Formula | C12H27O4P |
1-Dodecylphosphonic acid, 95%
CAS: 5137-70-2 Molecular Formula: C12H27O3P Molecular Weight (g/mol): 250.32 MDL Number: MFCD00015832 InChI Key: SVMUEEINWGBIPD-UHFFFAOYSA-N Synonym: n-dodecylphosphonic acid,phosphonic acid, dodecyl,n-dodecanephosphonic acid,dodecane phosphonic acid,1-dodecanephosphonic acid,n-dodecyl phosphonic acid,dodecyl-phosphonic acid,1-dodecylphosphonic acid,phosphonic acid, p-dodecyl,n-dodecylphosphonicacid PubChem CID: 78816 IUPAC Name: dodecylphosphonic acid SMILES: CCCCCCCCCCCCP(O)(O)=O
| PubChem CID | 78816 |
|---|---|
| CAS | 5137-70-2 |
| Molecular Weight (g/mol) | 250.32 |
| MDL Number | MFCD00015832 |
| SMILES | CCCCCCCCCCCCP(O)(O)=O |
| Synonym | n-dodecylphosphonic acid,phosphonic acid, dodecyl,n-dodecanephosphonic acid,dodecane phosphonic acid,1-dodecanephosphonic acid,n-dodecyl phosphonic acid,dodecyl-phosphonic acid,1-dodecylphosphonic acid,phosphonic acid, p-dodecyl,n-dodecylphosphonicacid |
| IUPAC Name | dodecylphosphonic acid |
| InChI Key | SVMUEEINWGBIPD-UHFFFAOYSA-N |
| Molecular Formula | C12H27O3P |
Hydroxypropyl-beta-cyclodextrin, TCI America™
CAS: 128446-35-5 Molecular Formula: C44H75O36 Molecular Weight (g/mol): 1180.05 MDL Number: MFCD00074978
| CAS | 128446-35-5 |
|---|---|
| Molecular Weight (g/mol) | 1180.05 |
| MDL Number | MFCD00074978 |
| Molecular Formula | C44H75O36 |
Toluene-2,4-diisocyanate, tech. 80%, remainder 2,6-diisocyanate
CAS: 584-84-9 Molecular Formula: C9H6N2O2 Molecular Weight (g/mol): 174.159 MDL Number: MFCD00002011 InChI Key: DVKJHBMWWAPEIU-UHFFFAOYSA-N Synonym: 2,4-toluene diisocyanate,2,4-diisocyanatotoluene,tolylene-2,4-diisocyanate,toluene-2,4-diisocyanate,2,4-tolylene diisocyanate,toluene 2,4-diisocyanate,4-methyl-m-phenylene diisocyanate,tolylene diisocyanate,2,4-tdi,toluylene-2,4-diisocyanate PubChem CID: 11443 ChEBI: CHEBI:53556 IUPAC Name: 2,4-diisocyanato-1-methylbenzene SMILES: CC1=C(C=C(C=C1)N=C=O)N=C=O
| PubChem CID | 11443 |
|---|---|
| CAS | 584-84-9 |
| Molecular Weight (g/mol) | 174.159 |
| ChEBI | CHEBI:53556 |
| MDL Number | MFCD00002011 |
| SMILES | CC1=C(C=C(C=C1)N=C=O)N=C=O |
| Synonym | 2,4-toluene diisocyanate,2,4-diisocyanatotoluene,tolylene-2,4-diisocyanate,toluene-2,4-diisocyanate,2,4-tolylene diisocyanate,toluene 2,4-diisocyanate,4-methyl-m-phenylene diisocyanate,tolylene diisocyanate,2,4-tdi,toluylene-2,4-diisocyanate |
| IUPAC Name | 2,4-diisocyanato-1-methylbenzene |
| InChI Key | DVKJHBMWWAPEIU-UHFFFAOYSA-N |
| Molecular Formula | C9H6N2O2 |
Heptafluorobutyric acid, 99%
CAS: 375-22-4 Molecular Formula: C4HF7O2 Molecular Weight (g/mol): 214.04 MDL Number: MFCD00004171 InChI Key: YPJUNDFVDDCYIH-UHFFFAOYSA-N Synonym: heptafluorobutyric acid,perfluorobutyric acid,heptafluorobutanoic acid,perfluorobutanoic acid,butanoic acid, heptafluoro,heptafluoro-1-butanoic acid,perfluoropropanecarboxylic acid,butyric acid, heptafluoro,kyselina heptafluormaselna,kyselina heptafluormaselna czech PubChem CID: 9777 ChEBI: CHEBI:39426 IUPAC Name: 2,2,3,3,4,4,4-heptafluorobutanoic acid SMILES: C(=O)(C(C(C(F)(F)F)(F)F)(F)F)O
| PubChem CID | 9777 |
|---|---|
| CAS | 375-22-4 |
| Molecular Weight (g/mol) | 214.04 |
| ChEBI | CHEBI:39426 |
| MDL Number | MFCD00004171 |
| SMILES | C(=O)(C(C(C(F)(F)F)(F)F)(F)F)O |
| Synonym | heptafluorobutyric acid,perfluorobutyric acid,heptafluorobutanoic acid,perfluorobutanoic acid,butanoic acid, heptafluoro,heptafluoro-1-butanoic acid,perfluoropropanecarboxylic acid,butyric acid, heptafluoro,kyselina heptafluormaselna,kyselina heptafluormaselna czech |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutanoic acid |
| InChI Key | YPJUNDFVDDCYIH-UHFFFAOYSA-N |
| Molecular Formula | C4HF7O2 |
N-(1-Naphthyl)ethylenediamine Dihydrochloride, ACS Reagent Grade, Ricca Chemical
CAS: 1465-25-4 Molecular Formula: C12H16Cl2N2 Molecular Weight (g/mol): 259.174 InChI Key: MZNYWPRCVDMOJG-UHFFFAOYSA-N Synonym: n-1-naphthyl ethylenediamine dihydrochloride,n1-naphthalen-1-yl ethane-1,2-diamine dihydrochloride,marshall's reagent,n-1-naphthylethylenediamine dihydrochloride,ccris 425,unii-h734599kjl,1,2-ethanediamine, n-1-naphthalenyl-, dihydrochloride,2-1-naphthylamino ethylamine 2hcl,bratton-marshall reagent,n-1-naphthalenyl-1,2-ethanediamine dihydrochloride PubChem CID: 15106 ChEBI: CHEBI:53452 IUPAC Name: N'-naphthalen-1-ylethane-1,2-diamine;dihydrochloride SMILES: C1=CC=C2C(=C1)C=CC=C2NCCN.Cl.Cl
| PubChem CID | 15106 |
|---|---|
| CAS | 1465-25-4 |
| Molecular Weight (g/mol) | 259.174 |
| ChEBI | CHEBI:53452 |
| SMILES | C1=CC=C2C(=C1)C=CC=C2NCCN.Cl.Cl |
| Synonym | n-1-naphthyl ethylenediamine dihydrochloride,n1-naphthalen-1-yl ethane-1,2-diamine dihydrochloride,marshall's reagent,n-1-naphthylethylenediamine dihydrochloride,ccris 425,unii-h734599kjl,1,2-ethanediamine, n-1-naphthalenyl-, dihydrochloride,2-1-naphthylamino ethylamine 2hcl,bratton-marshall reagent,n-1-naphthalenyl-1,2-ethanediamine dihydrochloride |
| IUPAC Name | N'-naphthalen-1-ylethane-1,2-diamine;dihydrochloride |
| InChI Key | MZNYWPRCVDMOJG-UHFFFAOYSA-N |
| Molecular Formula | C12H16Cl2N2 |
Urea, 99.5%, for analysis
CAS: 57-13-6 Molecular Formula: CH4N2O Molecular Weight (g/mol): 60.06 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC Name: urea SMILES: C(=O)(N)N
| PubChem CID | 1176 |
|---|---|
| CAS | 57-13-6 |
| Molecular Weight (g/mol) | 60.06 |
| ChEBI | CHEBI:48376 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O |
Potassium Amylxanthate 97.0+%, TCI America™
CAS: 2720-73-2 Molecular Formula: C6H11KOS2 Molecular Weight (g/mol): 202.37 MDL Number: MFCD00059150 InChI Key: YIBBMDDEXKBIAM-UHFFFAOYSA-M Synonym: Amylxanthic Acid Potassium Salt, Potassium O-Amyl Dithiocarbonate PubChem CID: 493949 IUPAC Name: potassium [(pentyloxy)methanethioyl]sulfanide SMILES: [K+].CCCCCOC([S-])=S
| PubChem CID | 493949 |
|---|---|
| CAS | 2720-73-2 |
| Molecular Weight (g/mol) | 202.37 |
| MDL Number | MFCD00059150 |
| SMILES | [K+].CCCCCOC([S-])=S |
| Synonym | Amylxanthic Acid Potassium Salt, Potassium O-Amyl Dithiocarbonate |
| IUPAC Name | potassium [(pentyloxy)methanethioyl]sulfanide |
| InChI Key | YIBBMDDEXKBIAM-UHFFFAOYSA-M |
| Molecular Formula | C6H11KOS2 |