Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
4-Dimethylaminopyridine, 99%
CAS: 1122-58-3 MDL Number: MFCD00006418 InChI Key: VHYFNPMBLIVWCW-UHFFFAOYSA-N Synonym: 4-dimethylaminopyridine,dmap,4-dimethylamino pyridine,4-pyridinamine, n,n-dimethyl,n,n-dimethyl-4-pyridinamine,p-dimethylaminopyridine,pyridine, 4-dimethylamino,ccris 6176,dimethylpyridin-4-ylamine PubChem CID: 14284 IUPAC Name: N,N-dimethylpyridin-4-amine SMILES: CN(C)C1=CC=NC=C1
| PubChem CID | 14284 |
|---|---|
| CAS | 1122-58-3 |
| MDL Number | MFCD00006418 |
| SMILES | CN(C)C1=CC=NC=C1 |
| Synonym | 4-dimethylaminopyridine,dmap,4-dimethylamino pyridine,4-pyridinamine, n,n-dimethyl,n,n-dimethyl-4-pyridinamine,p-dimethylaminopyridine,pyridine, 4-dimethylamino,ccris 6176,dimethylpyridin-4-ylamine |
| IUPAC Name | N,N-dimethylpyridin-4-amine |
| InChI Key | VHYFNPMBLIVWCW-UHFFFAOYSA-N |
Bis(2-ethylhexyl) adipate, 99%
CAS: 103-23-1 Molecular Formula: C22H42O4 Molecular Weight (g/mol): 370.57 MDL Number: MFCD00009496 InChI Key: SAOKZLXYCUGLFA-UHFFFAOYSA-N Synonym: bis 2-ethylhexyl adipate,di 2-ethylhexyl adipate,diethylhexyl adipate,deha,plastomoll doa,beha,vestinol oa,bisoflex doa,effomoll doa PubChem CID: 7641 ChEBI: CHEBI:34675 IUPAC Name: bis(2-ethylhexyl) hexanedioate SMILES: CCCCC(CC)COC(=O)CCCCC(=O)OCC(CC)CCCC
| PubChem CID | 7641 |
|---|---|
| CAS | 103-23-1 |
| Molecular Weight (g/mol) | 370.57 |
| ChEBI | CHEBI:34675 |
| MDL Number | MFCD00009496 |
| SMILES | CCCCC(CC)COC(=O)CCCCC(=O)OCC(CC)CCCC |
| Synonym | bis 2-ethylhexyl adipate,di 2-ethylhexyl adipate,diethylhexyl adipate,deha,plastomoll doa,beha,vestinol oa,bisoflex doa,effomoll doa |
| IUPAC Name | bis(2-ethylhexyl) hexanedioate |
| InChI Key | SAOKZLXYCUGLFA-UHFFFAOYSA-N |
| Molecular Formula | C22H42O4 |
Urea, MP Biomedicals
CAS: 57-13-6 Molecular Formula: CH4N2O Molecular Weight (g/mol): 60.056 MDL Number: MFCD00008022 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC Name: urea SMILES: C(=O)(N)N
| PubChem CID | 1176 |
|---|---|
| CAS | 57-13-6 |
| Molecular Weight (g/mol) | 60.056 |
| ChEBI | CHEBI:48376 |
| MDL Number | MFCD00008022 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O |
Thermo Scientific Chemicals Hydroxypropyl cellulose, Average M.W. 100.000
CAS: 9004-64-2 Molecular Formula: (C24H44O16)n MDL Number: MFCD00132688 Synonym: 4-1-aminopropyl-n,n,3-trimethylaniline,4-dimethylamino-alpha,2-dimethylphenethylamine,benzeneethanamine, 4-dimethylamino-alpha,2-dimethyl,amiflamin,55875-51-9 di-hydrochloride,hydroxypropyl cellulose, m.w. 100,000,4-1-aminopropyl-n,n,3-trimethyl-aniline,hydroxypropyl cellulose 6-10 mpa?s in water at 20 ?c,hydroxypropyl cellulose, 3-6 mpa?s in water at 20 ?c
| CAS | 9004-64-2 |
|---|---|
| MDL Number | MFCD00132688 |
| Synonym | 4-1-aminopropyl-n,n,3-trimethylaniline,4-dimethylamino-alpha,2-dimethylphenethylamine,benzeneethanamine, 4-dimethylamino-alpha,2-dimethyl,amiflamin,55875-51-9 di-hydrochloride,hydroxypropyl cellulose, m.w. 100,000,4-1-aminopropyl-n,n,3-trimethyl-aniline,hydroxypropyl cellulose 6-10 mpa?s in water at 20 ?c,hydroxypropyl cellulose, 3-6 mpa?s in water at 20 ?c |
| Molecular Formula | (C24H44O16)n |
p-Nitrophenol, >99%, MP Biomedicals™
CAS: 100-02-7 Molecular Formula: C6H5NO3 Molecular Weight (g/mol): 139.11 MDL Number: MFCD00007331 InChI Key: BTJIUGUIPKRLHP-UHFFFAOYSA-N Synonym: p-nitrophenol,phenol, 4-nitro,paranitrophenol,niphen,4-hydroxynitrobenzene,p-hydroxynitrobenzene,phenol, p-nitro,mononitrophenol,paranitrofenol,paranitrofenolo PubChem CID: 980 ChEBI: CHEBI:16836 IUPAC Name: 4-nitrophenol SMILES: OC1=CC=C(C=C1)[N+]([O-])=O
| PubChem CID | 980 |
|---|---|
| CAS | 100-02-7 |
| Molecular Weight (g/mol) | 139.11 |
| ChEBI | CHEBI:16836 |
| MDL Number | MFCD00007331 |
| SMILES | OC1=CC=C(C=C1)[N+]([O-])=O |
| Synonym | p-nitrophenol,phenol, 4-nitro,paranitrophenol,niphen,4-hydroxynitrobenzene,p-hydroxynitrobenzene,phenol, p-nitro,mononitrophenol,paranitrofenol,paranitrofenolo |
| IUPAC Name | 4-nitrophenol |
| InChI Key | BTJIUGUIPKRLHP-UHFFFAOYSA-N |
| Molecular Formula | C6H5NO3 |
Graphite powder, synthetic, -20+100 mesh, 99% C, 0.2% max Ash, Thermo Scientific Chemicals
CAS: 7782-42-5 Molecular Formula: C Molecular Weight (g/mol): 12.01 MDL Number: MFCD00133992 MFCD00144065 MFCD00146977 MFCD00211867 MFCD06411993 MFCD07370731 InChI Key: OKTJSMMVPCPJKN-UHFFFAOYSA-N Synonym: graphite,activated charcoal,norit,mineral,carbon-12,carbono,graphene,acticarbone,anthrasorb,carbosieve PubChem CID: 5462310 ChEBI: CHEBI:27594 IUPAC Name: carbon SMILES: [C]
| PubChem CID | 5462310 |
|---|---|
| CAS | 7782-42-5 |
| Molecular Weight (g/mol) | 12.01 |
| ChEBI | CHEBI:27594 |
| MDL Number | MFCD00133992 MFCD00144065 MFCD00146977 MFCD00211867 MFCD06411993 MFCD07370731 |
| SMILES | [C] |
| Synonym | graphite,activated charcoal,norit,mineral,carbon-12,carbono,graphene,acticarbone,anthrasorb,carbosieve |
| IUPAC Name | carbon |
| InChI Key | OKTJSMMVPCPJKN-UHFFFAOYSA-N |
| Molecular Formula | C |
4-Methylbenzenesulphonylhydrazide, 97%
CAS: 1576-35-8 Molecular Formula: C7H10N2O2S Molecular Weight (g/mol): 186.23 MDL Number: MFCD00007588 InChI Key: ICGLPKIVTVWCFT-UHFFFAOYSA-N Synonym: 4-methylbenzenesulfonhydrazide,p-toluenesulfonhydrazide,tosylhydrazine,p-toluenesulfonyl hydrazide,tosylhydrazide,p-tosylhydrazine,p-toluenesulfonylhydrazine,celogen tsh,ptsh,4-toluenesulfonyl hydrazide PubChem CID: 15303 IUPAC Name: 4-methylbenzenesulfonohydrazide SMILES: CC1=CC=C(C=C1)S(=O)(=O)NN
| PubChem CID | 15303 |
|---|---|
| CAS | 1576-35-8 |
| Molecular Weight (g/mol) | 186.23 |
| MDL Number | MFCD00007588 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NN |
| Synonym | 4-methylbenzenesulfonhydrazide,p-toluenesulfonhydrazide,tosylhydrazine,p-toluenesulfonyl hydrazide,tosylhydrazide,p-tosylhydrazine,p-toluenesulfonylhydrazine,celogen tsh,ptsh,4-toluenesulfonyl hydrazide |
| IUPAC Name | 4-methylbenzenesulfonohydrazide |
| InChI Key | ICGLPKIVTVWCFT-UHFFFAOYSA-N |
| Molecular Formula | C7H10N2O2S |
Furan-2,5-dicarboxylic acid, 98%
CAS: 3238-40-2 Molecular Formula: C6H4O5 Molecular Weight (g/mol): 156.09 MDL Number: MFCD00016582 InChI Key: CHTHALBTIRVDBM-UHFFFAOYSA-N Synonym: 2,5-furandicarboxylic acid,dehydromucic acid,furan-2,5-dicarbonsaeure,2,5-furandicarboxylicacid,2,5-furandicarboxylate,furane-alpha,alpha'-dicarboxylic acid,furan 2,5-dicarboxylic acid,furan-2,5-dicarboxylate,furane-.alpha.,.alpha.'-dicarboxylic acid,2,5 furan dicarboxylic acid PubChem CID: 76720 ChEBI: CHEBI:84212 IUPAC Name: furan-2,5-dicarboxylic acid SMILES: OC(=O)C1=CC=C(O1)C(O)=O
| PubChem CID | 76720 |
|---|---|
| CAS | 3238-40-2 |
| Molecular Weight (g/mol) | 156.09 |
| ChEBI | CHEBI:84212 |
| MDL Number | MFCD00016582 |
| SMILES | OC(=O)C1=CC=C(O1)C(O)=O |
| Synonym | 2,5-furandicarboxylic acid,dehydromucic acid,furan-2,5-dicarbonsaeure,2,5-furandicarboxylicacid,2,5-furandicarboxylate,furane-alpha,alpha'-dicarboxylic acid,furan 2,5-dicarboxylic acid,furan-2,5-dicarboxylate,furane-.alpha.,.alpha.'-dicarboxylic acid,2,5 furan dicarboxylic acid |
| IUPAC Name | furan-2,5-dicarboxylic acid |
| InChI Key | CHTHALBTIRVDBM-UHFFFAOYSA-N |
| Molecular Formula | C6H4O5 |
Poly(caprolactone) diol, average M.N. 2000
CAS: 36890-68-3 Molecular Formula: (C6H10O2)n MDL Number: MFCD23713083 SMILES: *-CCCCCC(=O)O-*
| CAS | 36890-68-3 |
|---|---|
| MDL Number | MFCD23713083 |
| SMILES | *-CCCCCC(=O)O-* |
| Molecular Formula | (C6H10O2)n |
Methanesulfonyl chloride, 99.5%
CAS: 124-63-0 Molecular Formula: CH3ClO2S Molecular Weight (g/mol): 114.54 MDL Number: MFCD00007454 InChI Key: QARBMVPHQWIHKH-UHFFFAOYSA-N Synonym: mesyl chloride,methylsulfonyl chloride,methyl sulfochloride,methanesulphonyl chloride,chloro methyl sulfone,methanesulfuryl chloride,methanesulfonic acid chloride,methyl sulfonyl chloride,chloromethyl sulfone,mesylchloride PubChem CID: 31297 IUPAC Name: methanesulfonyl chloride SMILES: CS(Cl)(=O)=O
| PubChem CID | 31297 |
|---|---|
| CAS | 124-63-0 |
| Molecular Weight (g/mol) | 114.54 |
| MDL Number | MFCD00007454 |
| SMILES | CS(Cl)(=O)=O |
| Synonym | mesyl chloride,methylsulfonyl chloride,methyl sulfochloride,methanesulphonyl chloride,chloro methyl sulfone,methanesulfuryl chloride,methanesulfonic acid chloride,methyl sulfonyl chloride,chloromethyl sulfone,mesylchloride |
| IUPAC Name | methanesulfonyl chloride |
| InChI Key | QARBMVPHQWIHKH-UHFFFAOYSA-N |
| Molecular Formula | CH3ClO2S |
mono-Methyl terephthalate, 97%
CAS: 1679-64-7 Molecular Formula: C9H8O4 Molecular Weight (g/mol): 180.16 MDL Number: MFCD00002557 InChI Key: REIDAMBAPLIATC-UHFFFAOYSA-N Synonym: 4-methoxycarbonyl benzoic acid,mono-methyl terephthalate,monomethyl terephthalate,methyl terephthalate,methyl hydrogen terephthalate,1,4-benzenedicarboxylic acid, monomethyl ester,terephthalic acid monomethyl ester,1,4-benzenedicarboxylic acid monomethyl ester,terephthalic acid, monomethyl ester,hydrogen methyl terephthalate PubChem CID: 15513 IUPAC Name: 4-methoxycarbonylbenzoic acid SMILES: COC(=O)C1=CC=C(C=C1)C(=O)O
| PubChem CID | 15513 |
|---|---|
| CAS | 1679-64-7 |
| Molecular Weight (g/mol) | 180.16 |
| MDL Number | MFCD00002557 |
| SMILES | COC(=O)C1=CC=C(C=C1)C(=O)O |
| Synonym | 4-methoxycarbonyl benzoic acid,mono-methyl terephthalate,monomethyl terephthalate,methyl terephthalate,methyl hydrogen terephthalate,1,4-benzenedicarboxylic acid, monomethyl ester,terephthalic acid monomethyl ester,1,4-benzenedicarboxylic acid monomethyl ester,terephthalic acid, monomethyl ester,hydrogen methyl terephthalate |
| IUPAC Name | 4-methoxycarbonylbenzoic acid |
| InChI Key | REIDAMBAPLIATC-UHFFFAOYSA-N |
| Molecular Formula | C9H8O4 |
4-Methoxybenzylchloride, 98%, stabilized
CAS: 824-94-2 Molecular Formula: C8H9ClO Molecular Weight (g/mol): 156.61 MDL Number: MFCD00000915 InChI Key: MOHYOXXOKFQHDC-UHFFFAOYSA-N Synonym: 4-methoxybenzyl chloride,4-methoxybenzylchloride,1-chloromethyl-4-methoxybenzene,p-methoxybenzyl chloride,p-anisyl chloride,alpha-chloro-4-methoxytoluene,p-chloromethyl anisole,benzene, 1-chloromethyl-4-methoxy,4-chloromethyl anisole,anisole, p-chloromethyl PubChem CID: 69993 IUPAC Name: 1-(chloromethyl)-4-methoxybenzene SMILES: COC1=CC=C(C=C1)CCl
| PubChem CID | 69993 |
|---|---|
| CAS | 824-94-2 |
| Molecular Weight (g/mol) | 156.61 |
| MDL Number | MFCD00000915 |
| SMILES | COC1=CC=C(C=C1)CCl |
| Synonym | 4-methoxybenzyl chloride,4-methoxybenzylchloride,1-chloromethyl-4-methoxybenzene,p-methoxybenzyl chloride,p-anisyl chloride,alpha-chloro-4-methoxytoluene,p-chloromethyl anisole,benzene, 1-chloromethyl-4-methoxy,4-chloromethyl anisole,anisole, p-chloromethyl |
| IUPAC Name | 1-(chloromethyl)-4-methoxybenzene |
| InChI Key | MOHYOXXOKFQHDC-UHFFFAOYSA-N |
| Molecular Formula | C8H9ClO |
Methyl acetate, 99+%, Extra Dry, AcroSeal™
CAS: 79-20-9 Molecular Formula: C3H6O2 Molecular Weight (g/mol): 74.08 MDL Number: MFCD00008711 InChI Key: KXKVLQRXCPHEJC-UHFFFAOYSA-N Synonym: tereton,devoton,acetic acid, methyl ester,methyl ethanoate,acetic acid methyl ester,methylacetat,acetate de methyle,methylacetaat,methyl acetic ester,octan metylu PubChem CID: 6584 ChEBI: CHEBI:77700 IUPAC Name: methyl acetate SMILES: CC(=O)OC
| PubChem CID | 6584 |
|---|---|
| CAS | 79-20-9 |
| Molecular Weight (g/mol) | 74.08 |
| ChEBI | CHEBI:77700 |
| MDL Number | MFCD00008711 |
| SMILES | CC(=O)OC |
| Synonym | tereton,devoton,acetic acid, methyl ester,methyl ethanoate,acetic acid methyl ester,methylacetat,acetate de methyle,methylacetaat,methyl acetic ester,octan metylu |
| IUPAC Name | methyl acetate |
| InChI Key | KXKVLQRXCPHEJC-UHFFFAOYSA-N |
| Molecular Formula | C3H6O2 |
Tricyclohexylphosphine, technical grade
CAS: 2622-14-2 Molecular Formula: C18H33P Molecular Weight (g/mol): 280.436 MDL Number: MFCD00003853 InChI Key: WLPUWLXVBWGYMZ-UHFFFAOYSA-N Synonym: tricyclohexylphosphine,tricyclohexyl phosphine,phosphine, tricyclohexyl,tricyclohexyl-phosphane,pcy3,tricyclohexylphosphine solution,tchp,p cy 3,phosphorus tricyclohexyl,tricyclohexylphosphine, dissolved in toluene concentration PubChem CID: 75806 IUPAC Name: tricyclohexylphosphane SMILES: C1CCC(CC1)P(C2CCCCC2)C3CCCCC3
| PubChem CID | 75806 |
|---|---|
| CAS | 2622-14-2 |
| Molecular Weight (g/mol) | 280.436 |
| MDL Number | MFCD00003853 |
| SMILES | C1CCC(CC1)P(C2CCCCC2)C3CCCCC3 |
| Synonym | tricyclohexylphosphine,tricyclohexyl phosphine,phosphine, tricyclohexyl,tricyclohexyl-phosphane,pcy3,tricyclohexylphosphine solution,tchp,p cy 3,phosphorus tricyclohexyl,tricyclohexylphosphine, dissolved in toluene concentration |
| IUPAC Name | tricyclohexylphosphane |
| InChI Key | WLPUWLXVBWGYMZ-UHFFFAOYSA-N |
| Molecular Formula | C18H33P |
3-Fluorophenylhydrazine hydrochloride, 97%
CAS: 2924-16-5 Molecular Formula: C6H7FN2·ClH Molecular Weight (g/mol): 162.59 MDL Number: MFCD00012934 InChI Key: SKVGLOFWEJFQKU-UHFFFAOYSA-N Synonym: 3-fluorophenylhydrazine hydrochloride,3-fluorophenyl hydrazine hydrochloride,3-fluorophenylhydrazine hcl,3-fluorophenyl hydrazine hcl,m-fluorophenylhydrazine hydrochloride,hydrazine, 3-fluorophenyl-, monohydrochloride,1-3-fluorophenyl hydrazine hydrochloride,3-fluoro-phenyl-hydrazine,pubchem3341,acmc-20a0dq PubChem CID: 2723914 IUPAC Name: (3-fluorophenyl)hydrazine;hydrochloride SMILES: C1=CC(=CC(=C1)F)NN.Cl
| PubChem CID | 2723914 |
|---|---|
| CAS | 2924-16-5 |
| Molecular Weight (g/mol) | 162.59 |
| MDL Number | MFCD00012934 |
| SMILES | C1=CC(=CC(=C1)F)NN.Cl |
| Synonym | 3-fluorophenylhydrazine hydrochloride,3-fluorophenyl hydrazine hydrochloride,3-fluorophenylhydrazine hcl,3-fluorophenyl hydrazine hcl,m-fluorophenylhydrazine hydrochloride,hydrazine, 3-fluorophenyl-, monohydrochloride,1-3-fluorophenyl hydrazine hydrochloride,3-fluoro-phenyl-hydrazine,pubchem3341,acmc-20a0dq |
| IUPAC Name | (3-fluorophenyl)hydrazine;hydrochloride |
| InChI Key | SKVGLOFWEJFQKU-UHFFFAOYSA-N |
| Molecular Formula | C6H7FN2·ClH |